A4684412
4-(Hydroxymethyl)phenoxyacetic acid , 98% , 68858-21-9
Synonym(s):
Anti-HMP;Anti-MINOS2;Anti-P87;Anti-P89
CAS NO.:68858-21-9
Empirical Formula: C9H10O4
Molecular Weight: 182.17
MDL number: MFCD00057827
EINECS: 677-017-0
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB20.00 | In Stock |
|
| 1G | RMB23.20 | In Stock |
|
| 5G | RMB61.60 | In Stock |
|
| 25G | RMB217.60 | In Stock |
|
| 100G | RMB705.60 | In Stock |
|
| 500g | RMB2367.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 112-114 °C |
| Boiling point: | 378.3±22.0 °C(Predicted) |
| Density | 1.316±0.06 g/cm3(Predicted) |
| storage temp. | -20°C |
| solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. |
| pka | 3.15±0.10(Predicted) |
| form | Crystalline Powder |
| color | Off-white |
| biological source | rabbit |
| BRN | 5260336 |
| InChI | InChI=1S/C9H10O4/c10-5-7-1-3-8(4-2-7)13-6-9(11)12/h1-4,10H,5-6H2,(H,11,12) |
| InChIKey | VUCNQOPCYRJCGQ-UHFFFAOYSA-N |
| SMILES | C(O)(=O)COC1=CC=C(CO)C=C1 |
| CAS DataBase Reference | 68858-21-9(CAS DataBase Reference) |
Description and Uses
4-(Hydroxymethyl)phenoxyacetic acid is a linkage agent used in solid-phase peptide synthesis according to the "FMOC-polyamide" technique.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 22-24/25-36/37/39-27-26 |
| WGK Germany | 3 |
| F | 10 |
| HS Code | 29189900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |






