A4740712
4-(Hydroxymethyl)benzoic acid , 99% , 3006-96-0
Synonym(s):
4-(Hydroxymethyl)benzoic acid
CAS NO.:3006-96-0
Empirical Formula: C8H8O3
Molecular Weight: 152.15
MDL number: MFCD00017598
EINECS: 628-233-9
| Pack Size | Price | Stock | Quantity |
| 1g | RMB24.00 | In Stock |
|
| 5G | RMB31.20 | In Stock |
|
| 10g | RMB59.20 | In Stock |
|
| 25G | RMB144.00 | In Stock |
|
| 100G | RMB552.00 | In Stock |
|
| 500g | RMB2448.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 182-185 °C (lit.) |
| Boiling point: | 140-150 °C(Press: 9 Torr) |
| Density | 1.314±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | DMSO, Methanol |
| form | Coarse Fibers |
| pka | 4.16±0.10(Predicted) |
| color | White |
| BRN | 2690023 |
| InChI | InChI=1S/C8H8O3/c9-5-6-1-3-7(4-2-6)8(10)11/h1-4,9H,5H2,(H,10,11) |
| InChIKey | WWYFPDXEIFBNKE-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=CC=C(CO)C=C1 |
| LogP | 0.930 |
| CAS DataBase Reference | 3006-96-0(CAS DataBase Reference) |
Description and Uses
4-(Hydroxymethyl)benzoic Acid is an intermediate in the synthesis of Eprosartan (E590100), a prototype of the imidazoleacrylic acid angiotensin II receptor antagonists used as an antihypertensive age nt.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P305+P351+P338-P280g-P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-37/39 |
| WGK Germany | 3 |
| HS Code | 29181990 |
| Storage Class | 11 - Combustible Solids |







