A5357912
α-Methyl-trans-cinnamaldehyde , 95% , 101-39-3
CAS NO.:101-39-3
Empirical Formula: C10H10O
Molecular Weight: 146.19
MDL number: MFCD00006976
EINECS: 202-938-8
| Pack Size | Price | Stock | Quantity |
| 25G | RMB33.60 | In Stock |
|
| 100G | RMB64.00 | In Stock |
|
| 500G | RMB149.60 | In Stock |
|
| 2.5KG | RMB674.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 148-149 °C27 mm Hg(lit.) |
| Density | 1.047 g/mL at 25 °C(lit.) |
| refractive index | n |
| FEMA | 2697 | ALPHA-METHYLCINNAMALDEHYDE |
| Flash point: | 175 °F |
| storage temp. | Inert atmosphere,2-8°C |
| solubility | Chloroform, Methanol (Slightly) |
| form | Oil |
| color | Colourless |
| Odor | at 100.00 %. sweet cinnamon spicy cassia |
| Odor Type | spicy |
| biological source | synthetic |
| Water Solubility | <0.1 g/100 mL at 21 ºC |
| Sensitive | Air Sensitive |
| JECFA Number | 683 |
| BRN | 507514 |
| Stability: | Stable. Combustible. Incompatible with strong oxidizing agents, strong bases. |
| Cosmetics Ingredients Functions | PERFUMING |
| InChI | 1S/C10H10O/c1-9(8-11)7-10-5-3-2-4-6-10/h2-8H,1H3/b9-7+ |
| InChIKey | VLUMOWNVWOXZAU-VQHVLOKHSA-N |
| SMILES | [H]C(=O)\C(C)=C(/[H])c1ccccc1 |
| LogP | 2.68 |
| CAS DataBase Reference | 101-39-3(CAS DataBase Reference) |
| NIST Chemistry Reference | 2-Propenal, 2-methyl-3-phenyl-(101-39-3) |
| EPA Substance Registry System | .alpha.-Methylcinnamaldehyde (101-39-3) |
Description and Uses
α-Methylcinnamaldehyde has a characteristic cinnamon-type odor with a soft, spicy flavor. May be synthesized by condensing benzaldehyde with propionic aldehyde in the presence of a 1% caustic soda solution; also by the controlled hydrogenation of α-methylcinnamic aldehyde.
alpha-Methyl-trans-cinnamaldehyde is a compound with antifungal activity for proteomics research use.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H227-H335-H315-H319 |
| Precautionary statements | P210e-P261-P280a-P305+P351+P338-P405-P501a-P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313 |
| PPE | Eyeshields, Gloves, multi-purpose combination respirator cartridge (US) |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 24/25 |
| WGK Germany | 1 |
| RTECS | GD6600000 |
| TSCA | TSCA listed |
| HS Code | 29122900 |
| Storage Class | 10 - Combustible liquids |







