A4687612
3-Hydroxyquinoline , 97% , 580-18-7
CAS NO.:580-18-7
Empirical Formula: C9H7NO
Molecular Weight: 145.16
MDL number: MFCD00169018
EINECS: 209-456-7
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB23.20 | In Stock |
|
| 1G | RMB56.00 | In Stock |
|
| 5G | RMB227.20 | In Stock |
|
| 25G | RMB879.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 198-202°C |
| Boiling point: | 264.27°C (rough estimate) |
| Density | 1.1555 (rough estimate) |
| refractive index | 1.4500 (estimate) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| pka | 4.28(at 20℃) |
| form | Crystalline Powder |
| color | Beige |
| Water Solubility | 587.9mg/L(20 ºC) |
| InChI | InChI=1S/C9H7NO/c11-8-5-7-3-1-2-4-9(7)10-6-8/h1-6,11H |
| InChIKey | IQQDNMHUOLMLNJ-UHFFFAOYSA-N |
| SMILES | N1C2C(=CC=CC=2)C=C(O)C=1 |
Description and Uses
3-Hydroxyquinoline is a chemical reagent used in the preparation cyclic peptides with an antitumor functionality. Quinoline derivative as a result of the metabolism by cytochrome P 450.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H332-H335 |
| Precautionary statements | P261-P280-P305+P351+P338 |
| Hazard Codes | Xn |
| Risk Statements | 22 |
| WGK Germany | WGK 3 |
| RTECS | VC4050000 |
| HS Code | 29334990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral |





