PRODUCT Properties
| Melting point: | 239-244 °C |
| Boiling point: | 264.27°C (rough estimate) |
| Density | 1.1555 (rough estimate) |
| refractive index | 1.4500 (estimate) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | Powder |
| pka | pK1:5.48(+1);pK2:8.85(0) (20°C) |
| color | Beige to pale brown |
| Water Solubility | 454.3mg/L(20 ºC) |
| InChI | InChI=1S/C9H7NO/c11-8-4-3-7-2-1-5-10-9(7)6-8/h1-6,11H |
| InChIKey | XCRPPAPDRUBKRJ-UHFFFAOYSA-N |
| SMILES | N1C2C(=CC=C(O)C=2)C=CC=1 |
| CAS DataBase Reference | 580-20-1(CAS DataBase Reference) |
| NIST Chemistry Reference | 7-Quinolinol(580-20-1) |
| EPA Substance Registry System | 7-Quinolinol (580-20-1) |
Description and Uses
7-Hydroxyquinoline is an amphoteric molecule containing both acidic hydroxyl and basic nitrogen moieties, exhibiting a solvent-dependent equilibrium between enol and keto/zwitterion tautomers[2][3]. The compound serves as a local reporter for examining drug-binding sites in human serum albumin and for measuring fluorescence spectra in ionic liquids such as [bmim][Tf2N] and [bmim][PF6] with varying methanol concentrations[2][3].
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313 |
| Hazard Codes | Xn,Xi |
| Risk Statements | 36/37/38-20/21/22-22 |
| Safety Statements | 36/37/39-26 |
| WGK Germany | WGK 3 |
| RTECS | VC4160000 |
| TSCA | TSCA listed |
| HazardClass | IRRITANT |
| HS Code | 29334900 |
| Storage Class | 11 - Combustible Solids |






