A4689712
1,6-Hexanediol dimethacrylate , 95%, containing 100ppmmehq stabilizers , 6606-59-3
Synonym(s):
1,6-Hexamethylene dimethacrylate;1,6-Hexanediyl dimethacrylate
CAS NO.:6606-59-3
Empirical Formula: C14H22O4
Molecular Weight: 254.32
MDL number: MFCD00015425
EINECS: 229-551-7
| Pack Size | Price | Stock | Quantity |
| 25ML | RMB39.20 | In Stock |
|
| 100ML | RMB91.20 | In Stock |
|
| 500ML | RMB336.00 | In Stock |
|
| 2.5L | RMB1287.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | <25 °C |
| Boiling point: | >315 °C (lit.) |
| Density | 0.995 g/mL at 25 °C (lit.) |
| vapor pressure | 0.02 mm Hg ( 100 °C) |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | Amber Vial, Refrigerator |
| solubility | Chloroform (Sparingly), Methanol (Slightly) |
| form | Oil |
| color | Colourless |
| Specific Gravity | 1.0020.995 |
| Water Solubility | 23mg/L at 20℃ |
| BRN | 1957290 |
| Stability: | Light Sensitive |
| Cosmetics Ingredients Functions | NAIL CONDITIONING |
| InChI | 1S/C14H22O4/c1-11(2)13(15)17-9-7-5-6-8-10-18-14(16)12(3)4/h1,3,5-10H2,2,4H3 |
| InChIKey | SAPGBCWOQLHKKZ-UHFFFAOYSA-N |
| SMILES | CC(=C)C(=O)OCCCCCCOC(=O)C(C)=C |
| LogP | 4.08 at 20℃ |
| CAS DataBase Reference | 6606-59-3(CAS DataBase Reference) |
| EPA Substance Registry System | 1,6-Hexanediol dimethacrylate (6606-59-3) |
Description and Uses
1,6-Hexanediol Dimethacrylate is used in preparation of sheet-shaped molding compound raw material and product for automotive field.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xn,Xi |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 26-36-37/39-24/25 |
| RIDADR | UN 3082 9/PG 3 |
| WGK Germany | 2 |
| F | 8-10-13-23 |
| TSCA | TSCA listed |
| HS Code | 29161290 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |







