A4690012
Hexafluoroacetylacetone , 98% , 1522-22-1
Synonym(s):
1,1,1,5,5,5-Hexafluoro-2,4-pentanedione;1,1,1,5,5,5-Hexafluoroacetylacetone
CAS NO.:1522-22-1
Empirical Formula: C5H2F6O2
Molecular Weight: 208.06
MDL number: MFCD00000426
EINECS: 216-191-0
| Pack Size | Price | Stock | Quantity |
| 1g | RMB40.80 | In Stock |
|
| 5G | RMB112.80 | In Stock |
|
| 25G | RMB395.20 | In Stock |
|
| 100G | RMB1489.60 | In Stock |
|
| 500g | RMB5519.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 70-71 °C (lit.) |
| Density | 1.47 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | 32 °C |
| storage temp. | Inert atmosphere,Room Temperature |
| form | Liquid |
| pka | 4.30±0.10(Predicted) |
| Specific Gravity | 1.470 |
| color | Clear colorless to slightly yellow |
| Water Solubility | Not miscible in water. |
| Sensitive | Hygroscopic |
| BRN | 1790138 |
| InChI | 1S/C5H2F6O2/c6-4(7,8)2(12)1-3(13)5(9,10)11/h1H2 |
| InChIKey | QAMFBRUWYYMMGJ-UHFFFAOYSA-N |
| SMILES | FC(F)(F)C(=O)CC(=O)C(F)(F)F |
| CAS DataBase Reference | 1522-22-1(CAS DataBase Reference) |
| EPA Substance Registry System | 2,4-Pentanedione, 1,1,1,5,5,5-hexafluoro- (1522-22-1) |
Description and Uses
1,1,1,5,5,5-Hexafluoro-2,4-pentanedione acts as a chelating ligand. It is used as liquid crystal intermediate.
Safety
| Symbol(GHS) | ![]() ![]() ![]() GHS02,GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H226-H302+H312+H332-H314 |
| Precautionary statements | P210-P280-P301+P312-P303+P361+P353-P304+P340+P310-P305+P351+P338 |
| PPE | Faceshields, Gloves, Goggles, type ABEK (EN14387) respirator filter |
| Hazard Codes | C,F,Xi |
| Risk Statements | 10-20/21/22-34 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | UN 2920 8/PG 2 |
| WGK Germany | 3 |
| F | 3 |
| Hazard Note | Flammable/Corrosive |
| TSCA | TSCA listed |
| HazardClass | 8 |
| PackingGroup | II |
| HS Code | 29147000 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Acute Tox. 3 Inhalation Acute Tox. 3 Oral Eye Dam. 1 Flam. Liq. 3 Skin Corr. 1B |
| Limited Quantities | 100ml (liquid) or 0.5 Kg (solid) |
| Excepted Quantities | Max Inner Pack (1g or 1ml) and Max Outer Pack (500g or 500ml) |








