A4700912
His-OMe.2HCl , 98% , 7389-87-9
CAS NO.：7389-87-9
Empirical Formula: C7H13Cl2N3O2
Molecular Weight: 242.1
MDL number: MFCD00012701
EINECS: 230-973-9
| Pack Size | Price | Stock | Quantity |
| 5G | RMB23.20 | In Stock |
|
| 25G | RMB64.00 | In Stock |
|
| 100G | RMB155.20 | In Stock |
|
| 500g | RMB715.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 207 °C (dec.)(lit.) |
| alpha | 9 º (c=2 in H2O) |
| refractive index | 10 ° (C=2, H2O) |
| storage temp. | Inert atmosphere,2-8°C |
| solubility | 100g/l |
| form | Fine Crystalline Powder |
| color | White |
| optical activity | [α]20/D +9.0°, c = 2 in H2O |
| Water Solubility | Soluble in dimethyl sulfoxide, methanol and water. |
| Sensitive | Hygroscopic |
| BRN | 3572010 |
| InChI | InChI=1/C7H11N3O2.2ClH/c1-12-7(11)6(8)2-5-3-9-4-10-5;;/h3-4,6H,2,8H2,1H3,(H,9,10);2*1H/t6-;;/s3 |
| InChIKey | DWAYENIPKPKKMV-ILKKLZGPSA-N |
| SMILES | C1(N=CNC=1)C[C@H](N)C(=O)OC.Cl.Cl |&1:6,r| |
| CAS DataBase Reference | 7389-87-9(CAS DataBase Reference) |
Description and Uses
Methyl L-histidinate dihydrochloride is used in the preparation of optically pure L-(+)-Ergothioneine.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29332900 |
