BD8008431
(S)-2-Amino-3-(1H-imidazol-4-yl)propanoic acid hydrochloride , 97% , 645-35-2
CAS NO.：645-35-2
Empirical Formula: C6H10ClN3O2
Molecular Weight: 191.62
MDL number: MFCD00064556
EINECS: 211-438-9
| Pack Size | Price | Stock | Quantity |
| 10g | RMB35.20 | In Stock |
|
| 25g | RMB54.40 | In Stock |
|
| 100g | RMB157.60 | In Stock |
|
| 500g | RMB596.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 243-244 °C(Solv: ethanol (64-17-5)) |
| Density | 1.472[at 20℃] |
| vapor pressure | 0Pa at 20℃ |
| storage temp. | Inert atmosphere,2-8°C |
| form | Crystalline |
| color | colorless |
| Water Solubility | 149.55g/L at 20℃ |
| BRN | 4168261 |
| InChI | InChI=1/C6H9N3O2.ClH/c7-5(6(10)11)1-4-2-8-3-9-4;/h2-3,5H,1,7H2,(H,8,9)(H,10,11);1H/t5-;/s3 |
| InChIKey | QZNNVYOVQUKYSC-USHJBNIQNA-N |
| SMILES | C(O)(=O)[C@H](CC1N=CNC=1)N.[H]Cl |&1:3,r| |
| LogP | -3.32 at 25℃ |
| CAS DataBase Reference | 645-35-2(CAS DataBase Reference) |
| EPA Substance Registry System | L-Histidine, monohydrochloride (645-35-2) |
Description and Uses
L-Histidine hydrochloride can undergo racemization due to heating in water, leading to the formation of DL-histidine. It can be used as a supplement in conditions of riboflavin vitamin deficiency.
Amino acid.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| RIDADR | UN 1789 8/PG 3 |
| WGK Germany | 2 |
| F | 10 |
