A4701012
Fmoc-L-4-Hydroxyproline , 98%(sumofenantiomers) , 88050-17-3
Synonym(s):
Fmoc-L -4-hydroxyproline;Fmoc-Hyp-OH;N-α-Fmoc-L-trans-4-hydroxyproline
CAS NO.:88050-17-3
Empirical Formula: C20H19NO5
Molecular Weight: 353.37
MDL number: MFCD00151929
EINECS: 1533716-785-6
| Pack Size | Price | Stock | Quantity |
| 1G | RMB23.20 | In Stock |
|
| 5G | RMB35.20 | In Stock |
|
| 25G | RMB129.60 | In Stock |
|
| 100g | RMB497.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 189-193 °C |
| Boiling point: | 595.5±50.0 °C(Predicted) |
| Density | 1.407±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. |
| form | Powder |
| pka | 3.74±0.40(Predicted) |
| color | White to off-white |
| optical activity | [α]20/D 60±2°, c = 1% in methanol |
| BRN | 4574378 |
| Major Application | peptide synthesis |
| InChI | InChI=1S/C20H19NO5/c22-12-9-18(19(23)24)21(10-12)20(25)26-11-17-15-7-3-1-5-13(15)14-6-2-4-8-16(14)17/h1-8,12,17-18,22H,9-11H2,(H,23,24)/t12-,18+/m1/s1 |
| InChIKey | GOUUPUICWUFXPM-XIKOKIGWSA-N |
| SMILES | N1(C(OCC2C3=C(C=CC=C3)C3=C2C=CC=C3)=O)C[C@H](O)C[C@H]1C(O)=O |
| CAS DataBase Reference | 88050-17-3(CAS DataBase Reference) |
Description and Uses
peptide synthesis
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P280-P302+P352-P362+P364 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29339900 |
| Storage Class | 11 - Combustible Solids |







