A4701412
4,4′-(Hexafluoroisopropylidene)diphenol , >98.0%(GC) , 1478-61-1
Synonym(s):
2,2-Bis(4-hydroxyphenyl)hexafluoropropane;4,4′-(Hexafluoroisopropylidene)diphenol;Bisphenol AF;Hexafluorobisphenol A
CAS NO.:1478-61-1
Empirical Formula: C15H10F6O2
Molecular Weight: 336.23
MDL number: MFCD00000439
EINECS: 216-036-7
| Pack Size | Price | Stock | Quantity |
| 5G | RMB23.20 | In Stock |
|
| 25G | RMB60.00 | In Stock |
|
| 100G | RMB179.20 | In Stock |
|
| 500G | RMB623.20 | In Stock |
|
| 2.5kg | RMB2865.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 160-163 °C(lit.) |
| Boiling point: | 400°C |
| Density | 1.3837 (estimate) |
| vapor pressure | 0Pa at 20℃ |
| Flash point: | >100°C |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| pka | 8.74±0.10(Predicted) |
| form | powder |
| color | White to Pale Beige |
| Water Solubility | Insoluble in water. |
| BRN | 1891568 |
| Major Application | cleaning products cosmetics food and beverages personal care |
| InChI | 1S/C15H10F6O2/c16-14(17,18)13(15(19,20)21,9-1-5-11(22)6-2-9)10-3-7-12(23)8-4-10/h1-8,22-23H |
| InChIKey | ZFVMWEVVKGLCIJ-UHFFFAOYSA-N |
| SMILES | Oc1ccc(cc1)C(c2ccc(O)cc2)(C(F)(F)F)C(F)(F)F |
| LogP | 2.79 at 20℃ |
| CAS DataBase Reference | 1478-61-1(CAS DataBase Reference) |
| EPA Substance Registry System | Phenol, 4,4'-[2,2,2-trifluoro-1-(trifluoromethyl)ethylidene]bis- (1478-61-1) |
Description and Uses
fluororubber crosslinking agent
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-37/39 |
| WGK Germany | 2 |
| RTECS | SN2780000 |
| Hazard Note | Corrosive |
| TSCA | TSCA listed |
| HS Code | 29081990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| Hazardous Substances Data | 1478-61-1(Hazardous Substances Data) |





