A4706557
7-Hydroxy-4-(trifluoromethyl)coumarin , 97% , 575-03-1
Synonym(s):
4-(Trifluoromethyl)umbelliferone
CAS NO.:575-03-1
Empirical Formula: C10H5F3O3
Molecular Weight: 230.14
MDL number: MFCD00037578
EINECS: 124-586-5
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB55.20 | In Stock |
|
| 1g | RMB143.20 | In Stock |
|
| 5g | RMB447.20 | In Stock |
|
| 25g | RMB1839.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 178-180 °C (lit.) |
| Boiling point: | 311.4±42.0 °C(Predicted) |
| Density | 1.4435 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | DMF: soluble |
| form | powder to crystal |
| pka | 7.23±0.20(Predicted) |
| color | White to Light yellow to Light orange |
| λmax | 330nm(Toluene)(lit.) |
| BRN | 210932 |
| InChI | InChI=1S/C10H5F3O3/c11-10(12,13)7-4-9(15)16-8-3-5(14)1-2-6(7)8/h1-4,14H |
| InChIKey | CCKWMCUOHJAVOL-UHFFFAOYSA-N |
| SMILES | C1(=O)OC2=CC(O)=CC=C2C(C(F)(F)F)=C1 |
| CAS DataBase Reference | 575-03-1(CAS DataBase Reference) |
Description and Uses
7-Hydroxy-4-(trifluoromethyl)coumarin can be used as a reference standard for fluorescent pH indicator.
7-Hydroxy-4-(trifluoromethyl)coumarin is an halogenated metabolite of Coumarin (C755380), an naturally occurring organic compound that exists in many plants. Coumarin is the precursor molecule in the synthesis of various synthetic anti-coagulant such as warfarin (W498500)/.
Safety
| Symbol(GHS) | ![]() GHS06 |
| Signal word | Danger |
| Hazard statements | H300-H315-H319-H335 |
| Precautionary statements | P301+P310+P330-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi,T |
| Risk Statements | 36/37/38-25 |
| Safety Statements | 26-36-45 |
| RIDADR | UN 2811 6.1/PG 3 |
| WGK Germany | 3 |
| F | 8-10 |
| HazardClass | IRRITANT |
| HS Code | 29322090 |







