BD0899353
7-Methoxy-4-(trifluoromethyl)-2H-chromen-2-one , 97% , 575-04-2
Synonym(s):
Methyl 4-(trifluoromethyl)umbelliferyl ether
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB278.40 | In Stock |
|
| 250mg | RMB415.20 | In Stock |
|
| 1g | RMB1062.40 | In Stock |
|
| 5g | RMB3741.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 113-114 °C(Solv: ethanol (64-17-5); water (7732-18-5)) |
| Boiling point: | 287.4±40.0 °C(Predicted) |
| Density | 1.418±0.06 g/cm3(Predicted) |
| storage temp. | −20°C |
| solubility | DMF: soluble |
| form | Solid |
| color | White to Off-White |
| BRN | 225039 |
| InChI | InChI=1S/C11H7F3O3/c1-16-6-2-3-7-8(11(12,13)14)5-10(15)17-9(7)4-6/h2-5H,1H3 |
| InChIKey | HAZHUELNIGDYQH-UHFFFAOYSA-N |
| SMILES | C1(=O)OC2=CC(OC)=CC=C2C(C(F)(F)F)=C1 |
Description and Uses
Fluorescent substrate for oxidoreductases, especially for Cytochrome P450.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| F | 8 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |






