A4715831
Dipotassium Nitrosodisulfonate , 90-95% , 14293-70-0
Synonym(s):
Fremy’s salt
CAS NO.:14293-70-0
Empirical Formula: K2NO7S2*
Molecular Weight: 268.33
MDL number: MFCD00010878
EINECS: 238-219-0
| Pack Size | Price | Stock | Quantity |
| 1g | RMB215.20 | In Stock |
|
| 5g | RMB799.20 | In Stock |
|
| 25G | RMB3119.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| storage temp. | 2-8°C |
| form | powder |
| InChI | InChI=1S/2K.H2NO7S2/c;;2-1(9(3,4)5)10(6,7)8/h;;(H,3,4,5)(H,6,7,8)/q2*+1;/p-2 |
| InChIKey | IHSLHAZEJBXKMN-UHFFFAOYSA-L |
| SMILES | S([O-])(=O)(=O)N([O])S([O-])(=O)=O.[K+].[K+] |^1:5| |
Description and Uses
Dipotassium Nitrosodisulfonate is a valuable radical molecule that performs oxadations on various chemical compounds including phenols, napthols, amines, indoles . It is an invaluable tool in EPR (electron paramagnetic studies) and has seen use in the synthesis of antitumor agents.
Safety
| Symbol(GHS) | ![]() ![]() GHS02,GHS07 |
| Signal word | Danger |
| Hazard statements | H260-H302+H312+H332 |
| Precautionary statements | P223-P231+P232-P280-P301+P312-P302+P352+P312-P304+P340+P312 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn,F |
| Risk Statements | 14-20/21/22-14/15 |
| Safety Statements | 36 |
| RIDADR | UN 2813 4.3/PG 1 |
| WGK Germany | 3 |
| RTECS | QZ1300000 |
| HazardClass | 4.3 |
| PackingGroup | II |
| HS Code | 28429080 |
| Storage Class | 4.3 - Hazardous materials which set free flammable gases upon contact with water |
| Hazard Classifications | Acute Tox. 4 Oral Water-react 1 |






