A4719112
Hexachloroacetone , 99% , 116-16-5
Synonym(s):
HCA;Hexachloroacetone
CAS NO.:116-16-5
Empirical Formula: C3Cl6O
Molecular Weight: 264.75
MDL number: MFCD00000796
EINECS: 204-129-5
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | -3 °C |
| Boiling point: | 66-70 °C6 mm Hg(lit.) |
| Density | 1.743 g/mL at 25 °C(lit.) |
| vapor pressure | 10-130Pa at 20-50℃ |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | Store below +30°C. |
| form | clear liquid |
| color | Colorless to Almost colorless |
| Water Solubility | SLIGHTLY SOLUBLE |
| BRN | 1707475 |
| Dielectric constant | 3.9900000000000002 |
| InChI | 1S/C3Cl6O/c4-2(5,6)1(10)3(7,8)9 |
| InChIKey | DOJXGHGHTWFZHK-UHFFFAOYSA-N |
| SMILES | ClC(Cl)(Cl)C(=O)C(Cl)(Cl)Cl |
| LogP | 2.48-2.59 at 30℃ |
| CAS DataBase Reference | 116-16-5(CAS DataBase Reference) |
| NIST Chemistry Reference | 2-Propanone, 1,1,1,3,3,3-hexachloro-(116-16-5) |
| EPA Substance Registry System | Hexachloroacetone (116-16-5) |
Description and Uses
Reagent used for the polymerization of vinyl compounds and for the conversion of nucleoside-3′-phosphonates to the corresponding phosphates
Safety
| Symbol(GHS) | ![]() ![]() GHS06,GHS09 |
| Signal word | Danger |
| Hazard statements | H302-H317-H331-H411 |
| Precautionary statements | P273-P280-P301+P312+P330-P302+P352-P304+P340+P311 |
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xn,N |
| Risk Statements | 22-51/53 |
| Safety Statements | 24/25-61 |
| RIDADR | UN 2661 6.1/PG 3 |
| WGK Germany | 2 |
| RTECS | UC2100000 |
| F | 19 |
| TSCA | TSCA listed |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29147090 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Inhalation Acute Tox. 4 Oral Aquatic Chronic 2 Skin Sens. 1 |
| Hazardous Substances Data | 116-16-5(Hazardous Substances Data) |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |







