A4721412
Hydrocortisone , 98% , 50-23-7
Synonym(s):
Cortisol;Hydrocortisone - CAS 50-23-7 - Calbiochem;Hydrocortisone, Chromatographic Standard - CAS 50-23-7 - Calbiochem;Kendall’s compound F;Reichstein’s substance M
CAS NO.:50-23-7
Empirical Formula: C21H30O5
Molecular Weight: 362.47
MDL number: MFCD00011654
EINECS: 200-020-1
| Pack Size | Price | Stock | Quantity |
| 1G | RMB48.80 | In Stock |
|
| 5G | RMB120.80 | In Stock |
|
| 25G | RMB406.40 | In Stock |
|
| 100G | RMB1360.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 211-214 °C(lit.) |
| alpha | 166 º (c=1, C2H5OH 25 ºC) |
| Boiling point: | 414.06°C (rough estimate) |
| Density | 1.0812 (rough estimate) |
| refractive index | 1.6120 (estimate) |
| Flash point: | 220°C |
| storage temp. | -20°C |
| solubility | H2O: 100 mg/mL |
| form | powder |
| color | White |
| PH | 5.0- 7.0 |
| biological source | non-animal source |
| Water Solubility | 319.7mg/L(25 ºC) |
| Decomposition | 220 ºC |
| Merck | 14,4787 |
| BRN | 1354819 |
| Stability: | Stable, but may be light sensitive. Incompatible with strong oxidizing agents. |
| Major Application | clinical testing clinical testing |
| InChIKey | JYGXADMDTFJGBT-VWUMJDOOSA-N |
| SMILES | C[C@]12CCC(=O)C=C1CC[C@H]3[C@@H]4CC[C@](O)(C(=O)CO)[C@@]4(C)C[C@H](O)[C@H]23 |
| LogP | 1.610 |
| CAS DataBase Reference | 50-23-7(CAS DataBase Reference) |
| NIST Chemistry Reference | Hydrocortisone(50-23-7) |
| EPA Substance Registry System | Hydrocortisone (50-23-7) |
Description and Uses
Principle glucocorticoid hormone produced by adrenal cortex. An anti-inflammatory hormone.
Safety
| Symbol(GHS) | ![]() GHS08 |
| Signal word | Danger |
| Hazard statements | H360Df-H373 |
| Precautionary statements | P202-P260-P280-P308+P313-P405-P501 |
| target organs | Eyes,Central nervous system |
| Hazard Codes | Xn |
| Risk Statements | 62-63 |
| Safety Statements | 36/37 |
| WGK Germany | 3 |
| RTECS | GM8925000 |
| TSCA | TSCA listed |
| HS Code | 29372100 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Acute Tox. 3 Dermal Acute Tox. 3 Inhalation Acute Tox. 3 Oral Flam. Liq. 2 STOT SE 1 |
| Hazardous Substances Data | 50-23-7(Hazardous Substances Data) |
| Toxicity | LD50 subcutaneous in mouse: > 500mg/kg |





