A4723712
5-Hexynoic acid , 95% , 53293-00-8
CAS NO.:53293-00-8
Empirical Formula: C6H8O2
Molecular Weight: 112.13
MDL number: MFCD00066346
EINECS: 610-982-8
| Pack Size | Price | Stock | Quantity |
| 1G | RMB117.60 | In Stock |
|
| 5G | RMB430.40 | In Stock |
|
| 25G | RMB1558.40 | In Stock |
|
| 100g | RMB5878.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 27°C (estimate) |
| Boiling point: | 224-225 °C(lit.) |
| Density | 1.016 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | 230 °F |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | Acetonitrile: Soluble: =10 mg/ml Methanol: Soluble: =10 mg/ml |
| pka | 4+-.0.10(Predicted) |
| form | Liquid |
| color | yellow |
| Water Solubility | Miscible with water. |
| BRN | 1743192 |
| InChI | InChI=1S/C6H8O2/c1-2-3-4-5-6(7)8/h1H,3-5H2,(H,7,8) |
| InChIKey | VPFMEXRVUOPYRG-UHFFFAOYSA-N |
| SMILES | C(O)(=O)CCCC#C |
| CAS DataBase Reference | 53293-00-8(CAS DataBase Reference) |
Description and Uses
5-Hexynoic acid is used in the preparation of hex-5-ynoic acid methyl ester by using p-toluenesulfonic acid as a reagent. It is also involved in chemical synthesis.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| RIDADR | 3265 |
| WGK Germany | 3 |
| F | 10-23 |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 29161900 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |






