A4725612
Furfuryl glycidyl ether , 96% , 5380-87-0
Synonym(s):
2,3-Epoxypropyl 2-furylmethyl ether;2-[(Oxiranylmethoxy)methyl]furan
CAS NO.:5380-87-0
Empirical Formula: C8H10O3
Molecular Weight: 154.16
MDL number: MFCD00013348
EINECS: 226-372-6
| Pack Size | Price | Stock | Quantity |
| 5G | RMB391.20 | In Stock |
|
| 25G | RMB1347.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 103-104 °C/11 mmHg (lit.) |
| Density | 1.122 g/mL at 25 °C |
| refractive index | n |
| Flash point: | 216 °F |
| storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C |
| form | Liquid |
| color | Colorless to yellow to orange |
| InChI | InChI=1S/C8H10O3/c1-2-7(10-3-1)4-9-5-8-6-11-8/h1-3,8H,4-6H2 |
| InChIKey | RUGWIVARLJMKDM-UHFFFAOYSA-N |
| SMILES | O1C=CC=C1COCC1CO1 |
| CAS DataBase Reference | 5380-87-0(CAS DataBase Reference) |
Description and Uses
2-[(Oxiran-2-ylmethoxy)methyl]furan is used in preparation and catalytic activity of boron phosphorus containing organic compounds.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H332 |
| Precautionary statements | P261-P271-P304+P340-P312 |
| PPE | Eyeshields, Gloves |
| Hazard Codes | Xn |
| Risk Statements | 20-19 |
| Safety Statements | 23-18-24/25 |
| WGK Germany | 3 |
| RTECS | LU1423000 |
| HS Code | 29321900 |
| Storage Class | 10 - Combustible liquids |


