A4728312
3-Hydroxyphenylacetylene , 97% , 10401-11-3
Synonym(s):
3-Ethynylphenol
| Pack Size | Price | Stock | Quantity |
| 1G | RMB151.20 | In Stock |
|
| 5G | RMB559.20 | In Stock |
|
| 25g | RMB2399.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 64-66 °C |
| Boiling point: | 75°C 3mm |
| Density | 1.083 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | 218 °F |
| storage temp. | Inert atmosphere,Store in freezer, under -20°C |
| solubility | Miscible with dimethylformamide. |
| pka | 9.30±0.10(Predicted) |
| form | Crystalline Powder |
| color | White to pale yellow |
| BRN | 2076613 |
| InChI | InChI=1S/C8H6O/c1-2-7-4-3-5-8(9)6-7/h1,3-6,9H |
| InChIKey | AODMJIOEGCBUQL-UHFFFAOYSA-N |
| SMILES | C1(O)=CC=CC(C#C)=C1 |
| CAS DataBase Reference | 10401-11-3(CAS DataBase Reference) |
Description and Uses
3-Hydroxyphenylacetylene is used as a fluorogenic and chromogenic probe for bacterial enzymes.
Safety
| Symbol(GHS) | ![]() ![]() GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H302-H318 |
| Precautionary statements | P280-P301+P312+P330-P305+P351+P338+P310 |
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xn |
| Risk Statements | 22-41-52/53 |
| Safety Statements | 26-37/39 |
| RIDADR | 2810 |
| WGK Germany | 2 |
| HazardClass | 8 |
| PackingGroup | Ⅲ |
| HS Code | 29071990 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Dam. 1 |







