A4735512
N-Cbz-L-4-Hydroxyproline methyl ester , 95% , 64187-48-0
CAS NO.:64187-48-0
Empirical Formula: C14H17NO5
Molecular Weight: 279.29
MDL number: MFCD00055851
EINECS: 613-498-5
| Pack Size | Price | Stock | Quantity |
| 5g | RMB32.00 | In Stock |
|
| 25G | RMB122.40 | In Stock |
|
| 100G | RMB439.20 | In Stock |
|
| 1g | RMB520.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 422.8±45.0 °C(Predicted) |
| Density | 1.313 |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. |
| form | viscous liquid |
| pka | 14.25±0.40(Predicted) |
| color | Pale yellow |
| optical activity | Consistent with structure |
| InChI | InChI=1S/C14H17NO5/c1-19-13(17)12-7-11(16)8-15(12)14(18)20-9-10-5-3-2-4-6-10/h2-6,11-12,16H,7-9H2,1H3/t11-,12+/m1/s1 |
| InChIKey | VVKAGQHUUDRPOI-NEPJUHHUSA-N |
| SMILES | N1(C(OCC2=CC=CC=C2)=O)C[C@H](O)C[C@H]1C(OC)=O |
Description and Uses
N-(Benzyloxycarbonyl)-4-hydroxyproline Methyl Ester, can be used as an intermediate in the synthesis of various pharmaceutical and biologically active compounds. It is used in the synthesis of Doripenem (D534800), an Antibacterial agent.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P301+P312-P302+P352-P304+P340-P305+P351+P338 |
| WGK Germany | 3 |
| HS Code | 2933.99.8290 |







