BD3042245
Benzyl(2S,4R)-4-hydroxy-2-(hydroxymethyl)pyrrolidine-1-carboxylate , 97% , 95687-41-5
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB32.00 | In Stock |
|
| 1g | RMB80.00 | In Stock |
|
| 5g | RMB284.00 | In Stock |
|
| 10g | RMB473.60 | In Stock |
|
| 25g | RMB1121.60 | In Stock |
|
| 100g | RMB4412.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 240 °C(lit.) |
| Density | 1.297 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | 2-8°C |
| pka | 14.56±0.40(Predicted) |
| form | clear liquid |
| color | Colorless to Light orange to Yellow |
| optical activity | [α]20/D 33°, c = 15 in chloroform |
| InChI | InChI=1S/C13H17NO4/c15-8-11-6-12(16)7-14(11)13(17)18-9-10-4-2-1-3-5-10/h1-5,11-12,15-16H,6-9H2/t11-,12+/m0/s1 |
| InChIKey | WDEQGLDWZMIMJM-NWDGAFQWSA-N |
| SMILES | N1(C(OCC2=CC=CC=C2)=O)C[C@H](O)C[C@H]1CO |
Description and Uses
peptide synthesis
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P271-P280 |
| Hazard Codes | Xi |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 2933998090 |







