A4737812
D-Homophenylalanine , 98% , 82795-51-5
Synonym(s):
(R)-2-Amino-4-phenylbutyric acid
CAS NO.:82795-51-5
Empirical Formula: C10H13NO2
Molecular Weight: 179.22
MDL number: MFCD00063091
EINECS: 1308068-626-2
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB23.20 | In Stock |
|
| 250MG | RMB24.00 | In Stock |
|
| 1G | RMB68.00 | In Stock |
|
| 5G | RMB216.00 | In Stock |
|
| 25g | RMB479.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | >300 °C (lit.) |
| alpha | -45 º (c=1, 3N HCl 19 ºC) |
| Boiling point: | 311.75°C (rough estimate) |
| Density | 1.1248 (rough estimate) |
| refractive index | -45 ° (C=1, 3mol/L HCl) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | Aqueous Acid (Sparingly), Aqueous Base (Slightly) |
| pka | 2.32±0.10(Predicted) |
| form | Solid |
| color | White to Off-White |
| optical activity | [α]20/D -45±1°, c =1% in 3 M HCl |
| BRN | 4675530 |
| Major Application | peptide synthesis |
| InChI | InChI=1/C10H13NO2/c11-9(10(12)13)7-6-8-4-2-1-3-5-8/h1-5,9H,6-7,11H2,(H,12,13)/t9-/s3 |
| InChIKey | JTTHKOPSMAVJFE-DJEYLCQNNA-N |
| SMILES | C(C1C=CC=CC=1)C[C@@H](N)C(=O)O |&1:8,r| |
| CAS DataBase Reference | 82795-51-5(CAS DataBase Reference) |
Description and Uses
D-Homophenylalanine is used in peptide synthesis as an amino acid protection monomer.
Safety
| Symbol(GHS) | ![]() ![]() ![]() ![]() GHS05,GHS06,GHS08,GHS02 |
| Signal word | Danger |
| Hazard statements | H311-H302-H314-H370-H373-H317-H334-H401-H226 |
| Precautionary statements | P501-P273-P272-P260-P270-P240-P210-P233-P243-P241-P242-P264-P280-P284-P370+P378-P308+P311-P361+P364-P303+P361+P353-P333+P313-P301+P330+P331-P301+P312+P330-P304+P340+P310-P305+P351+P338+P310-P403+P235-P405 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xi |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| HS Code | 29224999 |
| Storage Class | 11 - Combustible Solids |








