BD0688632
H-D-HoPro-OMe.HCl , 95% , 18650-38-9
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB32.00 | In Stock |
|
| 1g | RMB88.00 | In Stock |
|
| 5g | RMB434.40 | In Stock |
|
| 25g | RMB1382.40 | In Stock |
|
| 100g | RMB4879.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | >158°C (dec.) |
| storage temp. | Inert atmosphere,2-8°C |
| solubility | DMSO (Slightly, Sonicated), Methanol (Slightly) |
| form | Solid |
| color | White to Off-White |
| optical activity | Consistent with structure |
| Stability: | Hygroscopic |
| InChI | InChI=1/C7H13NO2.ClH/c1-10-7(9)6-4-2-3-5-8-6;/h6,8H,2-5H2,1H3;1H/t6-;/s3 |
| InChIKey | APCHKWZTSCBBJX-UZHXKHNSNA-N |
| SMILES | [C@H]1(NCCCC1)C(=O)OC.Cl |&1:0,r| |
Description and Uses
(R)-Piperidine-2-carboxylic Acid Methyl Ester Hydrochloride is used in preparation and application of aromatic compound having immunoregulatory function.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352-P305+P351+P338-P332+P313-P337+P313-P362 |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/37/39 |
| WGK Germany | WGK 3 |
| HS Code | 2933399990 |
| Storage Class | 11 - Combustible Solids |





