A4738512
Acetic Acid trans-2-Hexenyl Ester , 98% , 2497-18-9
CAS NO.:2497-18-9
Empirical Formula: C8H14O2
Molecular Weight: 142.2
MDL number: MFCD00009474
EINECS: 219-680-7
| Pack Size | Price | Stock | Quantity |
| 10g | RMB33.60 | In Stock |
|
| 25G | RMB68.00 | In Stock |
|
| 100G | RMB242.40 | In Stock |
|
| 50g | RMB255.20 | In Stock |
|
| 250g | RMB903.20 | In Stock |
|
| 500G | RMB934.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | -65.52°C (estimate) |
| Boiling point: | 165-166 °C (lit.) |
| Density | 0.898 g/mL at 25 °C (lit.) |
| FEMA | 2564 | 2-HEXEN-1-YL ACETATE (E) |
| refractive index | n |
| Flash point: | 137 °F |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| solubility | Almost insoluble in water, soluble in alcohol and oils. |
| form | clear liquid |
| color | Colorless to Almost colorless |
| Specific Gravity | 0.90 |
| Odor | Powerful and fresh-green, sweet and fruity, very “natural” odor |
| Odor Type | green |
| biological source | synthetic |
| JECFA Number | 1355 |
| BRN | 1721851 |
| Stability: | Stable. Combustible. Incompatible with strong bases, strong oxidizing agents. |
| Cosmetics Ingredients Functions | FLAVOURING PERFUMING FRAGRANCE |
| InChI | 1S/C8H14O2/c1-3-4-5-6-7-10-8(2)9/h5-6H,3-4,7H2,1-2H3/b6-5+ |
| InChIKey | HRHOWZHRCRZVCU-AATRIKPKSA-N |
| SMILES | [H]\C(CCC)=C(\[H])COC(C)=O |
| LogP | 2.58 |
| CAS DataBase Reference | 2497-18-9(CAS DataBase Reference) |
| NIST Chemistry Reference | 2-Hexen-1-ol, acetate, (E)-(2497-18-9) |
| EPA Substance Registry System | 2-Hexen-1-ol, acetate, (2E)- (2497-18-9) |
Description and Uses
trans-2-Hexen-l-yl acetate has a pleasant, fruity odor and corresponding taste. This substance may be synthesized by heating at the boil l-bromohexen-2 -ol with sodium acetate and acetic acid.
Safety
| Symbol(GHS) | ![]() ![]() GHS02,GHS07 |
| Signal word | Warning |
| Hazard statements | H226-H315-H319-H335 |
| Precautionary statements | P210-P233-P240-P241-P303+P361+P353-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-37/39 |
| RIDADR | UN 3272 3/PG 3 |
| WGK Germany | 2 |
| RTECS | MP8425000 |
| TSCA | TSCA listed |
| HazardClass | 3 |
| PackingGroup | III |
| HS Code | 29153900 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Eye Irrit. 2 Flam. Liq. 3 Skin Irrit. 2 STOT SE 3 |







