A4739212
δ-HCH solution , analyticalstandard,50ug/mlinmethanol:toluene(4:1) , 319-86-8
Synonym(s):
δ-1,2,3,4,5,6-Hexachlorocyclohexane;δ-1,2,3,4,5,6-Hexachlorocyclohexane solution;δ-HCH solution;delta-BHC
CAS NO.:319-86-8
Empirical Formula: C6H6Cl6
Molecular Weight: 290.83
MDL number: MFCD00135947
EINECS: 206-272-9
| Pack Size | Price | Stock | Quantity |
| 2ML | RMB135.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 113-115 °C(lit.) |
| Boiling point: | 373.64°C (rough estimate) |
| Density | 1.7152 (rough estimate) |
| vapor pressure | 3.52 at 25 °C (Banerjee et al., 1990) |
| refractive index | 1.576-1.674 (589.3 nm 20℃) |
| Flash point: | 11 °C |
| storage temp. | 2-8°C |
| solubility | Soluble in ethanol, benzene, and chloroform (Weast, 1986) |
| form | Solid |
| BRN | 1907334 |
| Henry's Law Constant | (x 10-7 atm·m3/mol):
2.5 at 20 °C (approximate - calculated from water solubility and vapor pressure) |
| InChI | 1S/C6H6Cl6/c7-1-2(8)4(10)6(12)5(11)3(1)9/h1-6H/t1-,2-,3-,4+,5-,6- |
| InChIKey | JLYXXMFPNIAWKQ-GPIVLXJGSA-N |
| SMILES | Cl[C@@H]1[C@@H](Cl)[C@H](Cl)[C@@H](Cl)[C@H](Cl)[C@@H]1Cl |
| EPA Substance Registry System | .delta.-Hexachlorocyclohexane (319-86-8) |
Description and Uses
Insecticide.
Safety
| Symbol(GHS) | ![]() ![]() ![]() GHS02,GHS06,GHS08 |
| Signal word | Danger |
| Hazard statements | H225-H301+H311+H331-H370-H412 |
| Precautionary statements | P210-P273-P280-P301+P310-P303+P361+P353-P304+P340+P311 |
| Hazard Codes | T,N,F,Xn |
| Risk Statements | 20/21-25-48/22-50/53-64-39/23/24/25-23/24/25-11-40-21-67-65-38-52/53 |
| Safety Statements | 36/37-45-60-61-22-16-7-62 |
| RIDADR | UN 2811 6.1/PG 1 |
| WGK Germany | 3 |
| RTECS | GV4900000 |
| TSCA | TSCA listed |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral Acute Tox. 4 Dermal Aquatic Acute 1 Aquatic Chronic 1 Carc. 2 |
| Hazardous Substances Data | 319-86-8(Hazardous Substances Data) |
| Toxicity | Acute oral LD50 for rats 1,000 mg/kg (RTECS, 1985). |





