A4740112
cis-3-Hexenyl benzoate , 97% , 25152-85-6
CAS NO.：25152-85-6
Empirical Formula: C13H16O2
Molecular Weight: 204.26
MDL number: MFCD00036526
EINECS: 246-669-4
| Pack Size | Price | Stock | Quantity |
| 5ml | RMB71.20 | In Stock |
|
| 25ML | RMB256.00 | In Stock |
|
| 100ml | RMB660.00 | In Stock |
|
| 500ml | RMB2799.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 105 °C1 mm Hg(lit.) |
| Density | 0.999 g/mL at 25 °C(lit.) |
| vapor pressure | 0.45Pa at 24℃ |
| refractive index | n |
| FEMA | 3688 | CIS-3-HEXENYL BENZOATE |
| Flash point: | >230 °F |
| storage temp. | Sealed in dry,Room Temperature |
| form | clear liquid |
| color | Colorless to Almost colorless |
| Odor | at 100.00 %. fresh green leafy floral orchid balsamic fatty |
| Odor Type | green |
| biological source | synthetic |
| Water Solubility | 40.3mg/L at 24℃ |
| JECFA Number | 858 |
| Major Application | flavors and fragrances |
| Cosmetics Ingredients Functions | PERFUMING |
| InChI | 1S/C13H16O2/c1-2-3-4-8-11-15-13(14)12-9-6-5-7-10-12/h3-7,9-10H,2,8,11H2,1H3/b4-3- |
| InChIKey | BCOXBEHFBZOJJZ-ARJAWSKDSA-N |
| SMILES | [H]\C(CC)=C(/[H])CCOC(=O)c1ccccc1 |
| LogP | 4.5 at 25℃ |
| CAS DataBase Reference | 25152-85-6(CAS DataBase Reference) |
| NIST Chemistry Reference | 3-Hexen-1-ol, benzoate, (z)-(25152-85-6) |
| EPA Substance Registry System | 3-Hexen-1-ol, benzoate, (3Z)- (25152-85-6) |
Description and Uses
cis-3-Hexenyl benzoate has a green, balsamic odor.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 2 |
| RTECS | DH1442500 |
| TSCA | TSCA listed |
| HS Code | 29163100 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
