A4745712
3-Hydroxy-2-nitropyridine , 98% , 15128-82-2
Synonym(s):
2-Nitro-3-pyridinol
CAS NO.：15128-82-2
Empirical Formula: C5H4N2O3
Molecular Weight: 140.1
MDL number: MFCD00006258
EINECS: 239-191-2
| Pack Size | Price | Stock | Quantity |
| 5g | RMB31.20 | In Stock |
|
| 10G | RMB92.80 | In Stock |
|
| 25g | RMB127.20 | In Stock |
|
| 50G | RMB306.40 | In Stock |
|
| 100g | RMB447.20 | In Stock |
|
| 250G | RMB990.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 69-71 °C (lit.) |
| Boiling point: | 256.56°C (rough estimate) |
| Density | 1.5657 (rough estimate) |
| refractive index | 1.4800 (estimate) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | DMSO (Slightly), Methanol (Slightly, Heated) |
| pka | 0.31±0.22(Predicted) |
| form | Crystalline Powder |
| color | Yellow |
| BRN | 124473 |
| InChI | InChI=1S/C5H4N2O3/c8-4-2-1-3-6-5(4)7(9)10/h1-3,8H |
| InChIKey | QBPDSKPWYWIHGA-UHFFFAOYSA-N |
| SMILES | C1([N+]([O-])=O)=NC=CC=C1O |
| CAS DataBase Reference | 15128-82-2(CAS DataBase Reference) |
| EPA Substance Registry System | 3-Hydroxy-2-nitropyridine (15128-82-2) |
Description and Uses
3-Hydroxy-2-nitropyridine may be used in the synthesis of novel sulfonates that are potent inhibitors of cell proliferation and tubulin polymerization.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39-36 |
| WGK Germany | 3 |
| RTECS | UU7715000 |
| Hazard Note | Irritant |
| HS Code | 29333990 |
| Toxicity | mouse,LD50,intravenous,180mg/kg (180mg/kg),U.S. Army Armament Research & Development Command, Chemical Systems Laboratory, NIOSH Exchange Chemicals. Vol. NX#04089, |
