A4755112
3-Hydroxy-2-methylpyridine , 99% , 1121-25-1
Synonym(s):
2-Methyl-3-pyridinol
CAS NO.：1121-25-1
Empirical Formula: C6H7NO
Molecular Weight: 109.13
MDL number: MFCD00082538
EINECS: 214-327-3
| Pack Size | Price | Stock | Quantity |
| 1G | RMB31.20 | In Stock |
|
| 5G | RMB102.40 | In Stock |
|
| 25G | RMB387.20 | In Stock |
|
| 100g | RMB1423.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 168-169 °C (lit.) |
| Boiling point: | 204.59°C (rough estimate) |
| Density | 1.1143 (rough estimate) |
| refractive index | 1.5040 (estimate) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | DMSO, Methanol |
| pka | 10.38±0.10(Predicted) |
| form | Powder |
| color | Beige-brown |
| BRN | 107937 |
| InChI | InChI=1S/C6H7NO/c1-5-6(8)3-2-4-7-5/h2-4,8H,1H3 |
| InChIKey | AQSRRZGQRFFFGS-UHFFFAOYSA-N |
| SMILES | C1(C)=NC=CC=C1O |
| LogP | 0.314 (est) |
| CAS DataBase Reference | 1121-25-1(CAS DataBase Reference) |
| NIST Chemistry Reference | 3-Pyridinol, 2-methyl-(1121-25-1) |
Description and Uses
3-Hydroxy-2-methylpyridine was used in the synthesis of pyrimidine.
Safety
| Symbol(GHS) |   GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H302-H315-H318-H335 |
| Precautionary statements | P280-P301+P312+P330-P302+P352-P305+P351+P338+P310 |
| Hazard Codes | Xn,Xi |
| Risk Statements | 22-37/38-41-36/37/38 |
| Safety Statements | 26-37/39-36/37/39-36 |
| WGK Germany | 3 |
| HS Code | 29333990 |
