A4746012
5-Hydroxyquinoline , 99% , 578-67-6
Synonym(s):
5-Hydroxyquinoline
CAS NO.：578-67-6
Empirical Formula: C9H7NO
Molecular Weight: 145.16
MDL number: MFCD00006792
EINECS: 209-428-4
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB23.20 | In Stock |
|
| 1G | RMB60.80 | In Stock |
|
| 5G | RMB196.00 | In Stock |
|
| 25G | RMB807.20 | In Stock |
|
| 100g | RMB3071.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 223-226 °C(lit.) |
| Boiling point: | 264.27°C (rough estimate) |
| Density | 1.1555 (rough estimate) |
| refractive index | 1.4500 (estimate) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | DMSO, Methanol |
| form | Solution |
| pka | pK1:5.20(＋1);pK2:8.54(0) (20°C) |
| color | Colorless to yellow, may darken during storage |
| Water Solubility | 416.5mg/L(20 ºC) |
| BRN | 114514 |
| InChI | InChI=1S/C9H7NO/c11-9-5-1-4-8-7(9)3-2-6-10-8/h1-6,11H |
| InChIKey | GYESAYHWISMZOK-UHFFFAOYSA-N |
| SMILES | N1C2C(=C(O)C=CC=2)C=CC=1 |
| CAS DataBase Reference | 578-67-6(CAS DataBase Reference) |
| NIST Chemistry Reference | 5-Quinolinol(578-67-6) |
Description and Uses
5-Quinolinol (5-Hydroxyquinoline) was used as an internal standard in the reaction to measure morphine concentration in serum or plasma. It was also used as a lipophilic chelator and it decreased the rate of deoxygenation.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| RTECS | VC4100000 |
| Hazard Note | Irritant |
| HS Code | 29334900 |
