A4746612
4-Hydroxy-7-methoxyquinoline , 97% , 82121-05-9
CAS NO.：82121-05-9
Empirical Formula: C10H9NO2
Molecular Weight: 175.18
MDL number: MFCD00169015
EINECS: 625-361-7
| Pack Size | Price | Stock | Quantity |
| 1G | RMB135.20 | In Stock |
|
| 5G | RMB446.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 75-77 |
| Boiling point: | 351.8±22.0 °C(Predicted) |
| Density | 1.258±0.06 g/cm3(Predicted) |
| storage temp. | Storage temp. 2-8°C |
| solubility | soluble in Methanol |
| form | powder to crystal |
| pka | 4.16±0.40(Predicted) |
| color | Light yellow to Brown to Dark green |
| InChI | InChI=1S/C10H9NO2/c1-13-7-2-3-8-9(6-7)11-5-4-10(8)12/h2-6H,1H3,(H,11,12) |
| InChIKey | NQUPXNZWBGZRQX-UHFFFAOYSA-N |
| SMILES | N1C2C(=CC=C(OC)C=2)C(O)=CC=1 |
| CAS DataBase Reference | 82121-05-9(CAS DataBase Reference) |
Description and Uses
4-Hydroxy-7-methoxyquinoline is a solid substance and it is a useful research chemical.
7-Methoxy-4-quinolinol is a heterocyclic organic compound and can be used as a pharmaceutical intermediate.
Safety
| Symbol(GHS) |   GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H302-H315-H318-H335 |
| Precautionary statements | P280-P301+P312+P330-P302+P352-P305+P351+P338+P310 |
| Hazard Codes | Xi,Xn |
| Risk Statements | 22-37/38-41 |
| Safety Statements | 26-36/37/39 |
| RIDADR | UN 3335 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HS Code | 2933499090 |
