A4746712
2-Hydroxy-5-nitrobenzoic acid , >98.0% , 96-97-9
Synonym(s):
2-Hydroxy-5-nitrobenzoic acid;5-Nitrosalicylic acid;5-Nitrosalicylic acid, 5-Nitro-2-hydroxybenzoic acid;Anilotic acid
CAS NO.:96-97-9
Empirical Formula: C7H5NO5
Molecular Weight: 183.12
MDL number: MFCD00007338
EINECS: 202-548-8
| Pack Size | Price | Stock | Quantity |
| 5G | RMB57.60 | In Stock |
|
| 10g | RMB103.20 | In Stock |
|
| 25G | RMB255.20 | In Stock |
|
| 100G | RMB959.20 | In Stock |
|
| 250g | RMB2215.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 228-230 °C(lit.) |
| Boiling point: | 316.77°C (rough estimate) |
| Density | 1,65 g/cm3 |
| vapor pressure | 0Pa at 25℃ |
| refractive index | 1.6280 (estimate) |
| storage temp. | no restrictions. |
| solubility | water: soluble1g in 1475ml(lit.) |
| pka | pK1:2.12 (25°C) |
| form | Liquid |
| color | Clear yellow-beige to orange-brown |
| Water Solubility | Soluble in water 1g/1475ml . |
| Merck | 14,6631 |
| BRN | 2213719 |
| InChI | 1S/C7H5NO5/c9-6-2-1-4(8(12)13)3-5(6)7(10)11/h1-3,9H,(H,10,11) |
| InChIKey | PPDRLQLKHRZIJC-UHFFFAOYSA-N |
| SMILES | OC(=O)c1cc(ccc1O)[N+]([O-])=O |
| LogP | 1.158 at 25℃ |
| CAS DataBase Reference | 96-97-9(CAS DataBase Reference) |
| EPA Substance Registry System | Benzoic acid, 2-hydroxy-5-nitro- (96-97-9) |
Description and Uses
5-Nitrosalicylic Acid is a salicylic acid derivative with anti-inflammatory effect against colitis.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352-P305+P351+P338-P332+P313-P337+P313 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-37/39 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| TSCA | TSCA listed |
| HS Code | 29182990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 |






