A6307112
3-Nitrosalicylic Acid , >98.0%(HPLC) , 85-38-1
Synonym(s):
2-Hydroxy-3-nitrobenzoic acid
| Pack Size | Price | Stock | Quantity |
| 5G | RMB204.00 | In Stock |
|
| 25G | RMB1079.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 142-147 °C |
| Boiling point: | 316.77°C (rough estimate) |
| Density | 1.6074 (rough estimate) |
| refractive index | 1.6280 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | DMSO (Sparingly), Methanol (Slightly) |
| form | Solid |
| pka | pK1:1.87 (25°C) |
| color | Pale Beige to Beige |
| Water Solubility | 1.3g/L(16 ºC) |
| Merck | 14,6631 |
| BRN | 2213132 |
| InChI | InChI=1S/C7H5NO5/c9-6-4(7(10)11)2-1-3-5(6)8(12)13/h1-3,9H,(H,10,11) |
| InChIKey | WWWFHFGUOIQNJC-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=CC=CC([N+]([O-])=O)=C1O |
| CAS DataBase Reference | 85-38-1(CAS DataBase Reference) |
| NIST Chemistry Reference | Salicylic acid, 3-nitro(85-38-1) |
Description and Uses
3-Nitrosalicylic acid (3NSA) is generally used as a corrosion inhibitor. It can be used as a supporting electrolyte for the electrodeposition of pyrrole on zinc for corrosion protection. 3NSA can also be used as a ligand for the synthesis of complexes with iron and aluminum for chelating therapy.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| RTECS | VO5300000 |
| HS Code | 29182900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |







