PRODUCT Properties
| Melting point: | 86-89 °C(lit.) |
| Boiling point: | 335.9±17.0 °C(Predicted) |
| Density | 1.260±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Chloroform (Slightly), DMSO (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 4.75±0.10(Predicted) |
| color | Pale Yellow |
| BRN | 1681601 |
| Stability: | Hygroscopic |
| InChI | InChI=1S/C9H10O3/c10-8-4-2-1-3-7(8)5-6-9(11)12/h1-4,10H,5-6H2,(H,11,12) |
| InChIKey | CJBDUOMQLFKVQC-UHFFFAOYSA-N |
| SMILES | C1(CCC(O)=O)=CC=CC=C1O |
| LogP | 1.100 (est) |
| CAS DataBase Reference | 495-78-3(CAS DataBase Reference) |
| EPA Substance Registry System | Benzenepropanoic acid, 2-hydroxy- (495-78-3) |
Description and Uses
3-(2-Hydroxyphenyl)propionic acid is suitable as a growth substrate for various strains of E. coli and as a standard in the study of microbial metabolism of catechin stereoisomers.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29182900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |







