S9018114
6-Hydroxy-DL-DOPA , ≥98%(HPLC),powder , 21373-30-8
| Pack Size | Price | Stock | Quantity |
| 5mg | RMB2555.61 | In Stock |
|
| 10mg | RMB4703.51 | In Stock |
|
| 100mg | RMB34377.98 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 515.2±38.0 °C(Predicted) |
| Density | 1.606±0.06 g/cm3(Predicted) |
| storage temp. | -20°C |
| solubility | H2O: soluble3mg/mL (Dissolve in oxygen-free boiled water containing 0.1% sodium metabisulfite or other antioxidant. Solutions should be freshly prepared and protected from exposure to light.) |
| form | powder |
| pka | 2.34±0.25(Predicted) |
| color | off-white |
| Water Solubility | H2O: 3mg/mL 1 M HCl: 50mg/mL (Solutions should be freshly prepared and protected from exposure to light.) |
| BRN | 2860065 |
| InChI | 1S/C9H11NO5/c10-5(9(14)15)1-4-2-7(12)8(13)3-6(4)11/h2-3,5,11-13H,1,10H2,(H,14,15) |
| InChIKey | YLKRUSPZOTYMAT-UHFFFAOYSA-N |
| SMILES | NC(Cc1cc(O)c(O)cc1O)C(O)=O |
Description and Uses
6-Hydroxy-DL-DOPA is a catecholamine neurotoxin and endogenous exicitotoxin even at non-NMDA receptors.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P280-P301+P312-P302+P352-P305+P351+P338 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| Storage Class | 11 - Combustible Solids |
