PRODUCT Properties
| Melting point: | 256-259℃ |
| Boiling point: | 507.3±35.0 °C(Predicted) |
| Density | 1.485±0.06 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | Soluble in 0.1 M NaOH: 0.1 g/mL. |
| pka | 0.19±0.10(Predicted) |
| form | solid |
| color | Yellow |
| InChI | InChI=1S/C6H5NO3/c8-5-1-2-7-3-4(5)6(9)10/h1-3H,(H,7,8)(H,9,10) |
| InChIKey | CHCUBGPSZDGABM-UHFFFAOYSA-N |
| SMILES | C1=NC=CC(O)=C1C(O)=O |
| CAS DataBase Reference | 609-70-1(CAS DataBase Reference) |
Description and Uses
4-Hydroxynicotinic acid, is used as a chemical synthesis reagent. It is also used as an important raw material and intermediate used in organic Synthesis, pharmaceuticals, agrochemicals and dyestuff.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38-20/21/22 |
| Safety Statements | 36/37/39-36/37-24/25 |
| HS Code | 29333990 |
