A4761812
5-Hydroxynicotinic Acid , 98% , 27828-71-3
Synonym(s):
5-Hydroxypyridine-3-carboxylic acid
CAS NO.：27828-71-3
Empirical Formula: C6H5NO3
Molecular Weight: 139.11
MDL number: MFCD00129117
EINECS: 622-583-6
| Pack Size | Price | Stock | Quantity |
| 1G | RMB23.20 | In Stock |
|
| 5G | RMB36.00 | In Stock |
|
| 25G | RMB128.00 | In Stock |
|
| 100G | RMB372.80 | In Stock |
|
| 500g | RMB1596.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 299 °C |
| Boiling point: | 519.3±35.0 °C(Predicted) |
| Density | 1.485±0.06 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,Room Temperature |
| form | powder to crystal |
| pka | 2.08±0.10(Predicted) |
| color | White to Yellow |
| BRN | 115847 |
| InChI | InChI=1S/C6H5NO3/c8-5-1-4(6(9)10)2-7-3-5/h1-3,8H,(H,9,10) |
| InChIKey | ATTDCVLRGFEHEO-UHFFFAOYSA-N |
| SMILES | C1=NC=C(O)C=C1C(O)=O |
| CAS DataBase Reference | 27828-71-3(CAS DataBase Reference) |
Description and Uses
5-Hydroxynicotinic acid is a nicotinic acid analog with potential inhibitory effect on the metabolism nicotinic acid by human platelets. Used in the investigation of the hydroxylation mechanism of the flaovoprotein 2-methyl-3-hydroxypyridine-5-carboxylic acid oxygenase (MHPCO).
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P280a-P304+P340-P405-P501a-P261-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| WGK Germany | 3 |
| RTECS | QT1757500 |
| Hazard Note | Harmful/Irritant/Keep Cold |
| HazardClass | IRRITANT |
| HS Code | 29333990 |
