A4765712
3-Hydroxy-5-methylpyridine , ≥97.0% , 42732-49-0
CAS NO.：42732-49-0
Empirical Formula: C6H7NO
Molecular Weight: 109.13
MDL number: MFCD00661297
EINECS: 640-433-8
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB101.60 | In Stock |
|
| 1G | RMB225.60 | In Stock |
|
| 5G | RMB959.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 136-140℃ |
| Boiling point: | 153 °C(Press: 5 Torr) |
| Density | 1.120±0.06 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 9.27±0.10(Predicted) |
| color | Light Brown to Brown |
| Water Solubility | Slightly soluble in water. |
| InChI | InChI=1S/C6H7NO/c1-5-2-6(8)4-7-3-5/h2-4,8H,1H3 |
| InChIKey | RYJNCIGFPWGVPA-UHFFFAOYSA-N |
| SMILES | C1=NC=C(C)C=C1O |
| CAS DataBase Reference | 42732-49-0(CAS DataBase Reference) |
Description and Uses
3-Hydroxy-5-methylpyridine is used to prepare 3-hydroxy-5-methyl-2-nitropyridine by nitration reaction.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P280g-P305+P351+P338 |
| HS Code | 2933399990 |
