S699579
≥98.0%(HPLC) , 529-96-4
Synonym(s):
4-Aminomethyl-5-hydroxy-6-methyl-3-pyridylmethyl phosphate
CAS NO.：529-96-4
Empirical Formula: C8H13N2O5P
Molecular Weight: 248.17
MDL number: MFCD00023504
EINECS: 208-471-6
| Pack Size | Price | Stock | Quantity |
| 10mg | RMB5999.82 | In Stock |
|
| 50mg | RMB22331.92 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 607.3±65.0 °C(Predicted) |
| Density | 1.559±0.06 g/cm3(Predicted) |
| pka | pKa 8.61(H2O
t = 25
I = 0.15)(Approximate) |
| form | Solid |
| color | White to yellow |
| BRN | 233653 |
| InChI | 1S/C8H13N2O5P/c1-5-8(11)7(2-9)6(3-10-5)4-15-16(12,13)14/h3,11H,2,4,9H2,1H3,(H2,12,13,14) |
| InChIKey | ZMJGSOSNSPKHNH-UHFFFAOYSA-N |
| SMILES | Cc1ncc(COP(O)(O)=O)c(CN)c1O |
Description and Uses
Pyridoxamine-5''-phosphate is a chromophore that plays a crucial role in the biosynthesis of deoxysugars (e.g. 2-Deoxy-2-chloro-D-glucose [D232570]). Pyridoxamine-5''-phosphate is naturally found in rat liver.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26 |
| WGK Germany | 2 |
| RTECS | UT4710000 |
| F | 3-10 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
