Hexachlorophene , ≥98.0% , 70-30-4
Synonym(s):
2,2′-Methylenebis(3,4,6-trichlorophenol);Hexachlorophene
CAS NO.:70-30-4
Empirical Formula: C13H6Cl6O2
Molecular Weight: 406.9
MDL number: MFCD00002171
EINECS: 200-733-8
PRODUCT Properties
| Melting point: | 163-165 °C(lit.) |
| Boiling point: | 519.9°C (rough estimate) |
| Density | 1.6065 (rough estimate) |
| refractive index | 1.5550 (estimate) |
| Flash point: | 11 °C |
| storage temp. | 2-8°C |
| solubility | DMF: 30 mg/ml; DMSO: 30 mg/ml; Ethanol: 30 mg/ml; Ethanol:PBS (pH 7.2) (1:4): 0.2 mg/ml |
| form | crystalline |
| pka | pKa 4.89 ± 0.02(H2O,t = 25.0±0.1,I=0.1(NaCl)) (Uncertain) |
| color | off-white to tan |
| Water Solubility | 19mg/L(25 ºC) |
| λmax | 300nm(MeOH)(lit.) |
| Merck | 14,4680 |
| BRN | 2064407 |
| Stability: | Stable. Incompatible with alkalies, akaline earths, tweens, strong oxidizers. |
| Major Application | agriculture cleaning products cosmetics environmental food and beverages personal care |
| Cosmetics Ingredients Functions | PRESERVATIVE |
| InChI | 1S/C13H6Cl6O2/c14-6-2-8(16)12(20)4(10(6)18)1-5-11(19)7(15)3-9(17)13(5)21/h2-3,20-21H,1H2 |
| InChIKey | ACGUYXCXAPNIKK-UHFFFAOYSA-N |
| SMILES | Oc1c(Cl)cc(Cl)c(Cl)c1Cc2c(O)c(Cl)cc(Cl)c2Cl |
| CAS DataBase Reference | 70-30-4(CAS DataBase Reference) |
| IARC | 3 (Vol. 20, Sup 7) 1987 |
| NIST Chemistry Reference | 2,2'-Methylenebis(3,4,6-trichlorophenol)(70-30-4) |
| EPA Substance Registry System | Hexachlorophene (70-30-4) |
Description and Uses
Hexachlorophene (HCP) is a chlorinated bisphenol antiseptic and was introduced for use as an antibacterial component in drug and cosmetic products in 1941. It has bacteriostatic activity against gram-positive organisms (e.g., staphylococcus) but not against gram-negative organisms. HCP is readily absorbed orally and through the skin of humans, especially skin of premature infants or damaged skin. Hexachlorophene is a neurotoxicant, and symptomology may include lethargy, muscle weakness, irritability, cerebral edema, and paralysis leading to coma and death. The US Food and Drug Administration restricted the use of hexachlorophene preparation to ≤0.1% in 1972 and approved it for surgical scrubbing and handwashing. HCP is no longer used extensively in hospitals, rest homes, etc., because of its toxicity.
Used as an antiseptic
Safety
| Symbol(GHS) | ![]() ![]() GHS06,GHS09 |
| Signal word | Danger |
| Hazard statements | H301+H311-H410 |
| Precautionary statements | P264-P270-P273-P280-P301+P310-P302+P352+P312 |
| PPE | dust mask type N95 (US), Eyeshields, Faceshields, Gloves, type P2 (EN 143) respirator cartridges |
| Hazard Codes | T,N,F |
| Risk Statements | 24/25-50/53-52/53-39/23/24/25-23/24/25-11-51/53 |
| Safety Statements | 20-37-45-60-61-36/37-16 |
| RIDADR | UN 2875 6.1/PG 3 |
| WGK Germany | 3 |
| RTECS | SM0700000 |
| TSCA | TSCA listed |
| HazardClass | 6.1(b) |
| PackingGroup | III |
| HS Code | 29072990 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Dermal Acute Tox. 3 Oral Aquatic Acute 1 Aquatic Chronic 1 |
| Hazardous Substances Data | 70-30-4(Hazardous Substances Data) |
| Toxicity | LD50 in adult male, female rats (mg/kg): 66, 57 orally (Gaines, Linder) |





