![Homopiperazine-N，N’-bis-[2-(ethanesulfonic acid)]](https://img.chemicalbook.com/CAS/GIF/202185-84-0.gif)
A4776012
Homopiperazine-N，N’-bis-[2-(ethanesulfonic acid)] , ≥97%(T) , 202185-84-0
Synonym(s):
Hexahydro-1H-1,4-diazepine-1,4-bis(2-ethanesulfonic acid);Homo-PIPES
CAS NO.：202185-84-0
Empirical Formula: C9H20N2O6S2
Molecular Weight: 316.39
MDL number: MFCD00467737
| Pack Size | Price | Stock | Quantity |
| 1g | RMB255.20 | In Stock |
|
| 5g | RMB879.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Density | 1.447±0.06 g/cm3(Predicted) |
| storage temp. | Store at RT. |
| solubility | H2O: 10 mg/mL, clear, colorless |
| pka | 0.54±0.50(Predicted) |
| form | Solid |
| color | White |
| InChI | 1S/C9H20N2O6S2/c12-18(13,14)8-6-10-2-1-3-11(5-4-10)7-9-19(15,16)17/h1-9H2,(H,12,13,14)(H,15,16,17) |
| InChIKey | QZTMPPUJIVQNKS-UHFFFAOYSA-N |
| SMILES | OS(=O)(=O)CCN1CCCN(CC1)CCS(O)(=O)=O |
Description and Uses
Homopiperazine-1,4-bis(2-ethanesulfonic acid) can be used in the immunoassay studies and as pretreatment reagents and methods, and application to assays for immunosuppressant drugs.
Safety
| Symbol(GHS) |   GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H312-H314 |
| Precautionary statements | P260-P280-P303+P361+P353-P304+P340+P310-P305+P351+P338-P362+P364 |
| PPE | Eyeshields, Faceshields, Gloves, type P3 (EN 143) respirator cartridges |
| Hazard Codes | C |
| Risk Statements | 21-34 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | UN 2585 8/PG 3 |
| WGK Germany | 3 |
| F | 3-10 |
| HS Code | 29339900 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Acute Tox. 4 Dermal Skin Corr. 1B |
