A4784612
3-Hydroxypyrazine-2-carboxamide , 98% , 55321-99-8
CAS NO.：55321-99-8
Empirical Formula: C5H5N3O2
Molecular Weight: 139.11
MDL number: MFCD00233977
EINECS: 202-303-5
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB24.00 | In Stock |
|
| 1G | RMB43.20 | In Stock |
|
| 5G | RMB142.40 | In Stock |
|
| 25G | RMB639.20 | In Stock |
|
| 100G | RMB2383.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | ca 270℃ |
| Density | 1.63±0.1 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | DMSO (Slightly), Aqueous Base (Slightly) |
| form | Solid |
| pka | 10.69±0.40(Predicted) |
| color | Pale Brown to Brown |
| λmax | 348nm(lit.) |
| Stability: | Hygroscopic |
| InChI | InChI=1S/C5H5N3O2/c6-4(9)3-5(10)8-2-1-7-3/h1-2H,(H2,6,9)(H,8,10) |
| InChIKey | SZPBAPFUXAADQV-UHFFFAOYSA-N |
| SMILES | C1(C(N)=O)=NC=CNC1=O |
Description and Uses
Apart from biological importance of pyridine-2-carboxamide (picolinamide, pia) as well as of its derivatives such as 3-hydroxypyridine-2-carboxamide (3-OHpia), as ligands they have found their extensive application in coordina- tion chemistry in crystal engineering .
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37 |
| HS Code | 29339900 |
