BD1510732
3-Chloropyrazine-2-carbonitrile , 98% , 55557-52-3
CAS NO.：55557-52-3
Empirical Formula: C5H2ClN3
Molecular Weight: 139.54
MDL number: MFCD00219653
EINECS: 670-636-7
| Pack Size | Price | Stock | Quantity |
| 5g | RMB36.00 | In Stock |
|
| 10g | RMB61.60 | In Stock |
|
| 25g | RMB150.40 | In Stock |
|
| 100g | RMB546.40 | In Stock |
|
| 500g | RMB2260.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 45-47°C |
| Boiling point: | 264.1±35.0 °C(Predicted) |
| Density | 1.43±0.1 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| pka | -5.41±0.10(Predicted) |
| form | solid |
| color | Light brown to black |
| InChI | InChI=1S/C5H2ClN3/c6-5-4(3-7)8-1-2-9-5/h1-2H |
| InChIKey | SDLFAEGTVBPHBK-UHFFFAOYSA-N |
| SMILES | C1(C#N)=NC=CN=C1Cl |
| CAS DataBase Reference | 55557-52-3(CAS DataBase Reference) |
Description and Uses
3-Chloropyrazine-2-carbonitrile is a reactant in the syntheses of tuberculostatic pyrazine derivatives.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332-H315-H319-H335 |
| Precautionary statements | P260-P280-P301+P310-P304+P340-P305+P351+P338-P312 |
| Hazard Codes | Xn |
| Risk Statements | 20/21/22-36/37/38-41-37/38-22 |
| Safety Statements | 26-36/37/39-39 |
| RIDADR | 3276 |
| Hazard Note | Harmful |
| HS Code | 2933998090 |
