A4786712
1H-benzimidazole-2-sulfonicacid , ≥98% , 40828-54-4
| Pack Size | Price | Stock | Quantity |
| 1G | RMB153.60 | In Stock |
|
| 5G | RMB607.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 116-119 °C(lit.) |
| Density | 1.4876 (rough estimate) |
| refractive index | 1.6000 (estimate) |
| storage temp. | 2-8°C |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | -1.47±0.40(Predicted) |
| color | Off-White to Pale Beige |
| InChI | 1S/C7H6N2O3S/c10-13(11,12)7-8-5-3-1-2-4-6(5)9-7/h1-4H,(H,8,9)(H,10,11,12) |
| InChIKey | GWXQTTKUYBEZBP-UHFFFAOYSA-N |
| SMILES | OS(=O)(=O)c1nc2ccccc2[nH]1 |
| CAS DataBase Reference | 40828-54-4(CAS DataBase Reference) |
Description and Uses
Benzimidazole 2-Sulfonic Acid is a versatile reactant used in the preparation of bis(benzimidazol-2-yl)amines with antitrichinellosis activity.
Safety
| Symbol(GHS) |  GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P280-P305+P351+P338-P310 |
| PPE | Eyeshields, Faceshields, Gloves, type P3 (EN 143) respirator cartridges |
| Hazard Codes | C |
| Risk Statements | 34 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | UN 3261 8/PG 2 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 2933998090 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Skin Corr. 1B |
