A4800512
2'-Hydroxy-5'-methyl-3'-nitroacetophenone , 98% , 66108-30-3
| Pack Size | Price | Stock | Quantity |
| 5G | RMB173.60 | In Stock |
|
| 25G | RMB648.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 133-136 °C(lit.) |
| Boiling point: | 254.0±35.0 °C(Predicted) |
| Density | 1.323±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C, stored under nitrogen |
| pka | 7+-.0.38(Predicted) |
| form | powder to crystal |
| color | Light yellow to Yellow to Orange |
| InChI | InChI=1S/C9H9NO4/c1-5-3-7(6(2)11)9(12)8(4-5)10(13)14/h3-4,12H,1-2H3 |
| InChIKey | XSHQMMIEZHWNAK-UHFFFAOYSA-N |
| SMILES | C(=O)(C1=CC(C)=CC([N+]([O-])=O)=C1O)C |
| CAS DataBase Reference | 66108-30-3(CAS DataBase Reference) |
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| HS Code | 29147000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |





