A4801112
1<i>H</i>,1<i>H</i>,2<i>H</i>,2<i>H</i>-Heptadecafluorodecyl Acrylate (stabilized with BHT + TBC) , > 97.0%(GC), containing stabilizers , 27905-45-9
Synonym(s):
1H,1H,2H,2H-Perfluorodecyl acrylate;3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-Heptadecafluorodecyl acrylate
CAS NO.:27905-45-9
Empirical Formula: C13H7F17O2
Molecular Weight: 518.17
MDL number: MFCD00042306
EINECS: 248-722-7
| Pack Size | Price | Stock | Quantity |
| 5g | RMB26.40 | In Stock |
|
| 10G | RMB41.60 | In Stock |
|
| 25g | RMB90.40 | In Stock |
|
| 50G | RMB160.80 | In Stock |
|
| 100g | RMB297.60 | In Stock |
|
| 250G | RMB654.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | -3°C |
| Boiling point: | 90 °C4 mm Hg(lit.) |
| Density | 1.637 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | 2-8°C |
| solubility | Chloroform, Methanol (Slightly), Water (Sparingly) |
| form | Liquid |
| color | Clear colorless |
| Specific Gravity | 1.596 |
| BRN | 5173337 |
| Stability: | Light Sensitive |
| InChI | 1S/C13H7F17O2/c1-2-5(31)32-4-3-6(14,15)7(16,17)8(18,19)9(20,21)10(22,23)11(24,25)12(26,27)13(28,29)30/h2H,1,3-4H2 |
| InChIKey | QUKRIOLKOHUUBM-UHFFFAOYSA-N |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)CCOC(=O)C=C |
| CAS DataBase Reference | 27905-45-9(CAS DataBase Reference) |
| EPA Substance Registry System | 1,1,2,2-Tetrahydroperfluorodecyl acrylate (27905-45-9) |
Description and Uses
(Perfluorooctyl)ethyl Acrylate is a reagent used in the synthesis of parahydrophobic polymer coatings, as well as polymer brushes for controlling surface lubrication.
Safety
| Symbol(GHS) | ![]() ![]() GHS07,GHS08 |
| Signal word | Danger |
| Hazard statements | H302+H332-H351-H360D-H362-H372 |
| Precautionary statements | P202-P260-P263-P301+P312-P304+P340+P312-P308+P313 |
| target organs | Liver |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 37/39-26-24/25 |
| WGK Germany | 3 |
| F | 10-23 |
| TSCA | TSCA listed |
| HazardClass | IRRITANT |
| HS Code | 29161290 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 4 Inhalation Acute Tox. 4 Oral Carc. 2 Eye Dam. 1 Lact. Repr. 1B STOT RE 1 |








