A4804412
Heptanoic Anhydride , >97.0%(T) , 626-27-7
CAS NO.:626-27-7
Empirical Formula: C14H26O3
Molecular Weight: 242.35
MDL number: MFCD00009536
EINECS: 210-940-5
| Pack Size | Price | Stock | Quantity |
| 25ML | RMB159.20 | In Stock |
|
| 100ML | RMB463.20 | In Stock |
|
| 500ML | RMB1240.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | -12 °C |
| Boiling point: | 278-282 °C |
| Density | 0.917 |
| vapor pressure | 0.22Pa at 25℃ |
| refractive index | 1.432-1.434 |
| Flash point: | 110 °C |
| storage temp. | Inert atmosphere,Room Temperature |
| form | Liquid |
| color | Clear light yellow |
| InChI | InChI=1S/C14H26O3/c1-3-5-7-9-11-13(15)17-14(16)12-10-8-6-4-2/h3-12H2,1-2H3 |
| InChIKey | DAPZDAPTZFJZTO-UHFFFAOYSA-N |
| SMILES | O(C(=O)CCCCCC)C(=O)CCCCCC |
| LogP | 5.58 at 25℃ |
| CAS DataBase Reference | 626-27-7(CAS DataBase Reference) |
| EPA Substance Registry System | Heptanoic acid, anhydride (626-27-7) |
Description and Uses
HEPTANOIC ANHYDRIDE is an acid anhydride compound that can be used as an esterifying agent in the preparation of esterified polysaccharides.
Safety
| Symbol(GHS) | ![]() GHS05 |
| Signal word | Danger |
| Hazard statements | H290-H314 |
| Precautionary statements | P234-P260-P264-P280-P301+P330+P331+P310-P303+P361+P353+P310+P363-P304+P340+P310-P305+P351+P338+P310-P390-P405-P406-P501 |
| Hazard Codes | C |
| Risk Statements | 34 |
| Safety Statements | 45-36/37/39-26-28 |
| RIDADR | 1760 |
| TSCA | TSCA listed |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 29159000 |
| REACH Registrations | Inactive |




