S366680
Styrene:MaleicAnhydrideCopolymer3:1 , 26762-29-8
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB2375.70 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Density | 1.27 g/mL at 25 °C(lit.) |
| refractive index | n |
| solubility | ketones, ethers and alkali: soluble |
| InChI | 1S/C9H12.C8H8.C4H2O3/c1-8(2)9-6-4-3-5-7-9;1-2-8-6-4-3-5-7-8;5-3-1-2-4(6)7-3/h3-8H,1-2H3;2-7H,1H2;1-2H |
| InChIKey | QQNZOECCMADQHL-UHFFFAOYSA-N |
| SMILES | C(C1C=CC=CC=1)(C)C.C(C1C=CC=CC=1)=C.O=C1C=CC(=O)O1 |
| CAS DataBase Reference | 26762-29-8 |
| EPA Substance Registry System | 2,5-Furandione, telomer with ethenylbenzene and (1-methylethyl)benzene (26762-29-8) |
Description and Uses
Poly(Styrene-co-maleic Anhydride), Cumene terminated is used in the formation of a polysulfone ultrafiltration membrane.






