PRODUCT Properties
| Melting point: | 184-188 °C (lit.) |
| Boiling point: | 300 °C/1 mmHg (lit.) |
| Density | 1.23 |
| Flash point: | 300°C/1mm |
| Water Solubility | Insoluble in water |
| solubility | Benzene (Slightly), Chloroform (Sparingly) |
| form | solid |
| Specific Gravity | 1.23 |
| color | White to Almost white |
| Hydrolytic Sensitivity | 1: no significant reaction with aqueous systems |
| Sensitive | Moisture Sensitive |
| BRN | 2957773 |
| InChI | 1S/C36H30O3Si3/c1-7-19-31(20-8-1)40(32-21-9-2-10-22-32)37-41(33-23-11-3-12-24-33,34-25-13-4-14-26-34)39-42(38-40,35-27-15-5-16-28-35)36-29-17-6-18-30-36/h1-30H |
| InChIKey | VCYDUTCMKSROID-UHFFFAOYSA-N |
| SMILES | O1[Si](O[Si](O[Si]1(c2ccccc2)c3ccccc3)(c4ccccc4)c5ccccc5)(c6ccccc6)c7ccccc7 |
| CAS DataBase Reference | 512-63-0(CAS DataBase Reference) |
| NIST Chemistry Reference | Hexaphenylcyclotrisiloxane(512-63-0) |
| EPA Substance Registry System | Cyclotrisiloxane, hexaphenyl- (512-63-0) |
Description and Uses
2,2,4,4,6,6-hexakis-phenyl-1,3,5,2,4,6-trioxatrisilinane is a henylsilsesquioxane with high thermal stability, used as a cross-coupling reagent used in palladium-?catalyzed cross-?coupling reactions with aryl halides.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HS Code | 29349990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
