A6554212
Octamethyltrisiloxane , ≥97.0%(GC) , 107-51-7
CAS NO.:107-51-7
Empirical Formula: C8H24O2Si3
Molecular Weight: 236.53
MDL number: MFCD01325012
EINECS: 203-497-4
| Pack Size | Price | Stock | Quantity |
| 25ML | RMB69.60 | In Stock |
|
| 100ML | RMB229.60 | In Stock |
|
| 500ml | RMB887.20 | In Stock |
|
| 2.5L | RMB3519.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | -82 °C (lit.) |
| Boiling point: | 153 °C (lit.) |
| Density | 0.82 g/mL at 25 °C (lit.) |
| vapor density | >1 (vs air) |
| vapor pressure | 5.3hPa at 25℃ |
| refractive index | n |
| Flash point: | 99 °F |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | Chloroform (Slightly), DMSO, Methanol (Slightly) |
| form | liquid |
| Specific Gravity | 0.82 |
| color | Colourless to Pale Yellow |
| Water Solubility | 34μg/L at 23℃ |
| Hydrolytic Sensitivity | 1: no significant reaction with aqueous systems |
| Merck | 14,6748 |
| BRN | 1753063 |
| Dielectric constant | 2.3(20℃) |
| Stability: | Hygroscopic |
| Cosmetics Ingredients Functions | SKIN CONDITIONING - MISCELLANEOUS ANTIFOAMING |
| InChI | 1S/C8H24O2Si3/c1-11(2,3)9-13(7,8)10-12(4,5)6/h1-8H3 |
| InChIKey | CXQXSVUQTKDNFP-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)O[Si](C)(C)O[Si](C)(C)C |
| LogP | 6.6 at 25.3℃ |
| CAS DataBase Reference | 107-51-7(CAS DataBase Reference) |
| EPA Substance Registry System | Trisiloxane, octamethyl- (107-51-7) |
Description and Uses
Octamethyltrisiloxane is a linear silicone oligomer. It is used as an excipient Dimethicones in pharmaceutical and cosmetic applications can provide long lasting lubricant, smooth feel and spreads easily. Studies demonstrate that it is able to maintain the conformational stability of certain adsorbed proteins such as bovine serum albumin (BSA). Used in the methylation of mercury(II) salts.
Safety
| Symbol(GHS) | ![]() GHS02 |
| Signal word | Warning |
| Hazard statements | H226 |
| Precautionary statements | P210-P233-P240-P241-P242-P243 |
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter |
| Risk Statements | 10 |
| Safety Statements | 23-24/25 |
| RIDADR | UN 1993 3/PG 3 |
| WGK Germany | 3 |
| F | 10-21 |
| TSCA | TSCA listed |
| HazardClass | 3.2 |
| PackingGroup | III |
| HS Code | 29319090 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Flam. Liq. 3 |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |






