A4819112
1,1,1,3,3,3-Hexafluoroisopropyl Methacrylate (stabilized with MEHQ) , >98.0%(GC) , 3063-94-3
Synonym(s):
HFiPMA
CAS NO.：3063-94-3
Empirical Formula: C7H6F6O2
Molecular Weight: 236.11
MDL number: MFCD00040105
EINECS: 221-309-9
| Pack Size | Price | Stock | Quantity |
| 1g | RMB52.00 | In Stock |
|
| 5g | RMB122.40 | In Stock |
|
| 25G | RMB410.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 99 °C |
| Density | 1.302 g/mL at 25 °C(lit.) |
| vapor pressure | 0.71 psi ( 20 °C) |
| refractive index | n |
| Flash point: | 58 °F |
| storage temp. | Flammables area |
| form | Liquid |
| Specific Gravity | 1.304 |
| color | Clear colorless |
| InChI | InChI=1S/C7H6F6O2/c1-3(2)4(14)15-5(6(8,9)10)7(11,12)13/h5H,1H2,2H3 |
| InChIKey | FMQPBWHSNCRVQJ-UHFFFAOYSA-N |
| SMILES | C(OC(C(F)(F)F)C(F)(F)F)(=O)C(C)=C |
| EPA Substance Registry System | Hexafluoroisopropyl methacrylate (3063-94-3) |
Safety
| Symbol(GHS) |   GHS02,GHS07 |
| Signal word | Danger |
| Hazard statements | H225-H302+H312+H332-H315-H319-H335 |
| Precautionary statements | P210-P280-P301+P312-P303+P361+P353-P304+P340+P312-P305+P351+P338 |
| Hazard Codes | F,Xn,Xi |
| Risk Statements | 11-20/21/22-36/37/38 |
| Safety Statements | 16-26-33-36 |
| RIDADR | UN 3272 3/PG 2 |
| WGK Germany | 3 |
| Hazard Note | Flammable/Irritant |
| TSCA | T |
| HazardClass | 3 |
| PackingGroup | II |
| HS Code | 29161900 |
| Limited Quantities | 1.0 L (0.3 gallon) (liquid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) |
